| Name | 1,5-diphenyl-3-thiocarbonohydrazide |
| Synonyms | usafek-3110 USAF ek-3110 Diphenylthiocarbazide DIPHENYL THIOCARBAZONE Urea, 1,3-dianilino-2-thio- 1,5-diphenyl-3-thiocarbonohydrazide Carbohydrazide, 1,5-diphenyl-3-thio- 2,2'-diphenyl-carbonothioicdihydrazid N'',N'''-Diphenylthiocarbonohydrazide N'',N'''-diphenylthiocarbonohydrazide 2,2'-diphenylcarbonothioicdihydrazide Carbonothioic dihydrazide, 2,2'-diphenyl- 1,5-DIPHENYL-3-THIOCARBO-HYDRAZIDE(TECHNICAL) |
| CAS | 622-03-7 |
| EINECS | 210-717-2 |
| InChI | InChI=1/C13H14N4S/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14-15H,(H2,16,17,18) |
| Molecular Formula | C13H14N4S |
| Molar Mass | 258.34 |
| Density | 1.2302 (rough estimate) |
| Melting Point | 155°C |
| Boling Point | 181°C (rough estimate) |
| Flash Point | 186°C |
| Solubility | slightly sol. in Ethanol |
| Vapor Presure | 4.25E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Gray to Brown |
| pKa | 8.04±0.70(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.5700 (estimate) |
| MDL | MFCD00046042 |
| Physical and Chemical Properties | Dark red crystalline powder. Melting point 156-158 °c (decomposition). Soluble in alkali and decomposition, slightly soluble in cold ethanol and benzene. When heated or melted, it becomes green. |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| RTECS | FF2800000 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | diphenylthiocarbazine is a hydrazine derivative which can be used as a pharmaceutical synthesis intermediate. tests for bismuth, cadmium, cobalt, copper, lead, silver, nickel, magnesium, and mercury. |
| production method | phenylhydrazine is reacted with carbon disulfide to obtain phenylhydrazine dithiocarbamate phenylhydrazine salt, which is heated to release hydrogen sulfide and ammonia, conversion to diphenylthiocarbazine in 60-75% yield. |